C8H12Br2Cl2N2 — CID 138109776
1-(3,5-dibromophenyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 138109776) has the molecular formula C8H12Br2Cl2N2 and a molecular weight of 366.91 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)ethane-1,2-diamine;dihydrochloride.
| Compound Name | 1-(3,5-dibromophenyl)ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 138109776 |
| Molecular Formula | C8H12Br2Cl2N2 |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 363.87 |
| IUPAC Name | 1-(3,5-dibromophenyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C8H10Br2N2.2ClH/c9-6-1-5(8(12)4-11)2-7(10)3-6;;/h1-3,8H,4,11-12H2;2*1H |
| InChIKey | XUBXGWVANHVIOI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |