C11H16Br2ClN — CID 171233554
(1S)-1-(3,5-dibromophenyl)pentan-1-amine;hydrochloride (PubChem CID 171233554) has the molecular formula C11H16Br2ClN and a molecular weight of 357.52 g/mol. Its IUPAC name is (1S)-1-(3,5-dibromophenyl)pentan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(3,5-dibromophenyl)pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171233554 |
| Molecular Formula | C11H16Br2ClN |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | (1S)-1-(3,5-dibromophenyl)pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@H](N)c1cc(Br)cc(Br)c1.Cl |
| InChI | InChI=1S/C11H15Br2N.ClH/c1-2-3-4-11(14)8-5-9(12)7-10(13)6-8;/h5-7,11H,2-4,14H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | OQZTWMGCNRKSRH-MERQFXBCSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |