C10H13Br2NO — CID 171233582
(4S)-4-amino-4-(3,5-dibromophenyl)butan-1-ol (PubChem CID 171233582) has the molecular formula C10H13Br2NO and a molecular weight of 323.03 g/mol. Its IUPAC name is (4S)-4-amino-4-(3,5-dibromophenyl)butan-1-ol.
| Compound Name | (4S)-4-amino-4-(3,5-dibromophenyl)butan-1-ol |
|---|---|
| PubChem CID | 171233582 |
| Molecular Formula | C10H13Br2NO |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | (4S)-4-amino-4-(3,5-dibromophenyl)butan-1-ol |
| SMILES | N[C@@H](CCCO)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C10H13Br2NO/c11-8-4-7(5-9(12)6-8)10(13)2-1-3-14/h4-6,10,14H,1-3,13H2/t10-/m0/s1 |
| InChIKey | LUHYGHWPRGAFHJ-JTQLQIEISA-N |
| XLogP | 2.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |