C9H11Br2N — CID 91121714
1-(3,5-dibromophenyl)propan-1-amine (PubChem CID 91121714) has the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)propan-1-amine.
| Compound Name | 1-(3,5-dibromophenyl)propan-1-amine |
|---|---|
| PubChem CID | 91121714 |
| Molecular Formula | C9H11Br2N |
| Molecular Weight | 293.00 g/mol |
| Exact Mass | 290.93 |
| IUPAC Name | 1-(3,5-dibromophenyl)propan-1-amine |
| SMILES | CCC(N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C9H11Br2N/c1-2-9(12)6-3-7(10)5-8(11)4-6/h3-5,9H,2,12H2,1H3 |
| InChIKey | GDUCQOXCBNLCLR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.00 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |