C9H11Br2NO — CID 131077040
(1S)-1-(3,5-dibromophenyl)-2-methoxyethanamine (PubChem CID 131077040) has the molecular formula C9H11Br2NO and a molecular weight of 309.00 g/mol. Its IUPAC name is (1S)-1-(3,5-dibromophenyl)-2-methoxyethanamine.
| Compound Name | (1S)-1-(3,5-dibromophenyl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 131077040 |
| Molecular Formula | C9H11Br2NO |
| Molecular Weight | 309.00 g/mol |
| Exact Mass | 306.92 |
| IUPAC Name | (1S)-1-(3,5-dibromophenyl)-2-methoxyethanamine |
| SMILES | COC[C@@H](N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C9H11Br2NO/c1-13-5-9(12)6-2-7(10)4-8(11)3-6/h2-4,9H,5,12H2,1H3/t9-/m1/s1 |
| InChIKey | FUXRKFXMBZYQNC-SECBINFHSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.00 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |