C9H12F2N2O — CID 131118509
4-[(1S)-1-amino-2-methoxyethyl]-2,6-difluoroaniline (PubChem CID 131118509) has the molecular formula C9H12F2N2O and a molecular weight of 202.20 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2-methoxyethyl]-2,6-difluoroaniline.
| Compound Name | 4-[(1S)-1-amino-2-methoxyethyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 131118509 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 4-[(1S)-1-amino-2-methoxyethyl]-2,6-difluoroaniline |
| SMILES | COC[C@@H](N)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C9H12F2N2O/c1-14-4-8(12)5-2-6(10)9(13)7(11)3-5/h2-3,8H,4,12-13H2,1H3/t8-/m1/s1 |
| InChIKey | CSPYWASHNIOGIU-MRVPVSSYSA-N |
| XLogP | 1.19 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|