C10H16N2O — CID 107503103
1-(2,6-dimethyl-4-pyridinyl)-2-methoxyethanamine (PubChem CID 107503103) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-pyridinyl)-2-methoxyethanamine.
| Compound Name | 1-(2,6-dimethyl-4-pyridinyl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 107503103 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(2,6-dimethyl-4-pyridinyl)-2-methoxyethanamine |
| SMILES | COCC(N)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C10H16N2O/c1-7-4-9(5-8(2)12-7)10(11)6-13-3/h4-5,10H,6,11H2,1-3H3 |
| InChIKey | TVKIZBLUEMVXFZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |