C10H16N2 — CID 107504745
(1S)-1-(2,6-dimethyl-4-pyridinyl)propan-1-amine (PubChem CID 107504745) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S)-1-(2,6-dimethyl-4-pyridinyl)propan-1-amine.
| Compound Name | (1S)-1-(2,6-dimethyl-4-pyridinyl)propan-1-amine |
|---|---|
| PubChem CID | 107504745 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (1S)-1-(2,6-dimethyl-4-pyridinyl)propan-1-amine |
| SMILES | CC[C@H](N)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C10H16N2/c1-4-10(11)9-5-7(2)12-8(3)6-9/h5-6,10H,4,11H2,1-3H3/t10-/m0/s1 |
| InChIKey | OCWNHAQYOKHQFE-JTQLQIEISA-N |
| XLogP | 2.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |