C15H16F2N2 — CID 107503055
2-(3,5-difluorophenyl)-1-(2,6-dimethyl-4-pyridinyl)ethanamine (PubChem CID 107503055) has the molecular formula C15H16F2N2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-(2,6-dimethyl-4-pyridinyl)ethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-1-(2,6-dimethyl-4-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 107503055 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-(2,6-dimethyl-4-pyridinyl)ethanamine |
| SMILES | Cc1cc(C(N)Cc2cc(F)cc(F)c2)cc(C)n1 |
| InChI | InChI=1S/C15H16F2N2/c1-9-3-12(4-10(2)19-9)15(18)7-11-5-13(16)8-14(17)6-11/h3-6,8,15H,7,18H2,1-2H3 |
| InChIKey | FBJAQXIDLJPTHQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |