C10H15NO — CID 107502848
1-(2,6-dimethyl-4-pyridinyl)propan-1-ol (PubChem CID 107502848) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-pyridinyl)propan-1-ol.
| Compound Name | 1-(2,6-dimethyl-4-pyridinyl)propan-1-ol |
|---|---|
| PubChem CID | 107502848 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1-(2,6-dimethyl-4-pyridinyl)propan-1-ol |
| SMILES | CCC(O)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C10H15NO/c1-4-10(12)9-5-7(2)11-8(3)6-9/h5-6,10,12H,4H2,1-3H3 |
| InChIKey | YSLOASYUFFVZCL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |