C8H11Br2ClN2 — CID 171213915
(1S)-1-(3,5-dibromophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 171213915) has the molecular formula C8H11Br2ClN2 and a molecular weight of 330.45 g/mol. Its IUPAC name is (1S)-1-(3,5-dibromophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | (1S)-1-(3,5-dibromophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 171213915 |
| Molecular Formula | C8H11Br2ClN2 |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 327.90 |
| IUPAC Name | (1S)-1-(3,5-dibromophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NC[C@@H](N)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C8H10Br2N2.ClH/c9-6-1-5(8(12)4-11)2-7(10)3-6;/h1-3,8H,4,11-12H2;1H/t8-;/m1./s1 |
| InChIKey | JNZMZVYEWQAQNP-DDWIOCJRSA-N |
| XLogP | 2.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |