3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid

C9H11BrN2O2 — CID 131080638

IUPAC3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid
SMILESNC[C@@H](N)c1cc(Br)cc(C(=O)O)c1
InChIInChI=1S/C9H11BrN2O2/c10-7-2-5(8(12)4-11)1-6(3-7)9(13)14/h1-3,8H,4,11-12H2,(H,13,14)/t8-/m1/s1
InChIKeyZLAWNNACNUWGHU-MRVPVSSYSA-N
MW259.10 g/mol
LogP1.11
Rot. Bonds3

About 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid

3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid (PubChem CID 131080638) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid.

Molecular Properties

Compound Name3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid
PubChem CID131080638
Molecular FormulaC9H11BrN2O2
Molecular Weight259.10 g/mol
Exact Mass258.00
IUPAC Name3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid
SMILESNC[C@@H](N)c1cc(Br)cc(C(=O)O)c1
InChIInChI=1S/C9H11BrN2O2/c10-7-2-5(8(12)4-11)1-6(3-7)9(13)14/h1-3,8H,4,11-12H2,(H,13,14)/t8-/m1/s1
InChIKeyZLAWNNACNUWGHU-MRVPVSSYSA-N
XLogP1.11
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.10
LogP ≤ 51.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid?
The IUPAC name of 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid (CID 131080638) is 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid.
What is the SMILES notation for 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid?
The canonical SMILES for 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid is NC[C@@H](N)c1cc(Br)cc(C(=O)O)c1.
What is the InChIKey of 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid?
The InChIKey is ZLAWNNACNUWGHU-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H11BrN2O2/c10-7-2-5(8(12)4-11)1-6(3-7)9(13)14/h1-3,8H,4,11-12H2,(H,13,14)/t8-/m1/s1.
What are the key properties of 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid?
3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid has a molecular weight of 259.10 g/mol, XLogP of 1.11, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-[(1S)-1,2-diaminoethyl]benzoic acid is sourced from PubChem (CID 131080638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).