C12H16N2O6 — CID 174924013
benzene-1,3,5-tricarboxylic acid;propane-1,2-diamine (PubChem CID 174924013) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;propane-1,2-diamine.
| Compound Name | benzene-1,3,5-tricarboxylic acid;propane-1,2-diamine |
|---|---|
| PubChem CID | 174924013 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;propane-1,2-diamine |
| SMILES | CC(N)CN.O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6.C3H10N2/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;1-3(5)2-4/h1-3H,(H,10,11)(H,12,13)(H,14,15);3H,2,4-5H2,1H3 |
| InChIKey | KLXZAGMKRNZFCN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |