About CID 173365109
CID 173365109 (PubChem CID 173365109) has the molecular formula C11H26N2Na2O8
and a molecular weight of 360.32 g/mol.
Molecular Properties
| Compound Name | CID 173365109 |
| PubChem CID | 173365109 |
| Molecular Formula | C11H26N2Na2O8 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | — |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CC(N)CN.[Na].[Na] |
| InChI | InChI=1S/C3H10N2.4C2H4O2.2Na/c1-3(5)2-4;4*1-2(3)4;;/h3H,2,4-5H2,1H3;4*1H3,(H,3,4);; |
| InChIKey | ZSVBNVCLFRKEGF-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 173365109 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173365109?
The IUPAC name of CID 173365109 (CID 173365109) is not available.
What is the SMILES notation for CID 173365109?
The canonical SMILES for CID 173365109 is CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CC(N)CN.[Na].[Na].
What is the InChIKey of CID 173365109?
The InChIKey is ZSVBNVCLFRKEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N2.4C2H4O2.2Na/c1-3(5)2-4;4*1-2(3)4;;/h3H,2,4-5H2,1H3;4*1H3,(H,3,4);;.
What are the key properties of CID 173365109?
CID 173365109 has a molecular weight of 360.32 g/mol, XLogP of -1.11, 1 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173365109 is sourced from PubChem (CID 173365109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).