C8H18N2O2 — CID 88814334
pentane-2,4-dione;propane-1,2-diamine (PubChem CID 88814334) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is pentane-2,4-dione;propane-1,2-diamine.
| Compound Name | pentane-2,4-dione;propane-1,2-diamine |
|---|---|
| PubChem CID | 88814334 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | pentane-2,4-dione;propane-1,2-diamine |
| SMILES | CC(=O)CC(C)=O.CC(N)CN |
| InChI | InChI=1S/C5H8O2.C3H10N2/c1-4(6)3-5(2)7;1-3(5)2-4/h3H2,1-2H3;3H,2,4-5H2,1H3 |
| InChIKey | WAIQCDAWLDFCLO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|