About pentane-2,4-dione;tris(propan-2-ol);titanium
pentane-2,4-dione;tris(propan-2-ol);titanium (PubChem CID 88807291) has the molecular formula C14H32O5Ti
and a molecular weight of 328.27 g/mol. Its IUPAC name is pentane-2,4-dione;tris(propan-2-ol);titanium.
Molecular Properties
| Compound Name | pentane-2,4-dione;tris(propan-2-ol);titanium |
| PubChem CID | 88807291 |
| Molecular Formula | C14H32O5Ti |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | pentane-2,4-dione;tris(propan-2-ol);titanium |
| SMILES | CC(=O)CC(C)=O.CC(C)O.CC(C)O.CC(C)O.[Ti] |
| InChI | InChI=1S/C5H8O2.3C3H8O.Ti/c1-4(6)3-5(2)7;3*1-3(2)4;/h3H2,1-2H3;3*3-4H,1-2H3; |
| InChIKey | CISNLOAUHJQSMM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pentane-2,4-dione;tris(propan-2-ol);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-2,4-dione;tris(propan-2-ol);titanium?
The IUPAC name of pentane-2,4-dione;tris(propan-2-ol);titanium (CID 88807291) is pentane-2,4-dione;tris(propan-2-ol);titanium.
What is the SMILES notation for pentane-2,4-dione;tris(propan-2-ol);titanium?
The canonical SMILES for pentane-2,4-dione;tris(propan-2-ol);titanium is CC(=O)CC(C)=O.CC(C)O.CC(C)O.CC(C)O.[Ti].
What is the InChIKey of pentane-2,4-dione;tris(propan-2-ol);titanium?
The InChIKey is CISNLOAUHJQSMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.3C3H8O.Ti/c1-4(6)3-5(2)7;3*1-3(2)4;/h3H2,1-2H3;3*3-4H,1-2H3;.
What are the key properties of pentane-2,4-dione;tris(propan-2-ol);titanium?
pentane-2,4-dione;tris(propan-2-ol);titanium has a molecular weight of 328.27 g/mol, XLogP of 1.71, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-2,4-dione;tris(propan-2-ol);titanium is sourced from PubChem (CID 88807291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).