3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid

C10H9BrO6 — CID 170825091

IUPAC3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid
SMILESO=C(O)c1cc(Br)cc(C(O)C(O)C(=O)O)c1
InChIInChI=1S/C10H9BrO6/c11-6-2-4(1-5(3-6)9(14)15)7(12)8(13)10(16)17/h1-3,7-8,12-13H,(H,14,15)(H,16,17)
InChIKeyKCFJVVLIEFLRGY-UHFFFAOYSA-N
MW305.08 g/mol
LogP0.63
Rot. Bonds4

About 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid

3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid (PubChem CID 170825091) has the molecular formula C10H9BrO6 and a molecular weight of 305.08 g/mol. Its IUPAC name is 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid.

Molecular Properties

Compound Name3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid
PubChem CID170825091
Molecular FormulaC10H9BrO6
Molecular Weight305.08 g/mol
Exact Mass303.96
IUPAC Name3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid
SMILESO=C(O)c1cc(Br)cc(C(O)C(O)C(=O)O)c1
InChIInChI=1S/C10H9BrO6/c11-6-2-4(1-5(3-6)9(14)15)7(12)8(13)10(16)17/h1-3,7-8,12-13H,(H,14,15)(H,16,17)
InChIKeyKCFJVVLIEFLRGY-UHFFFAOYSA-N
XLogP0.63
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.08
LogP ≤ 50.63
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid?
The IUPAC name of 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid (CID 170825091) is 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid.
What is the SMILES notation for 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid?
The canonical SMILES for 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid is O=C(O)c1cc(Br)cc(C(O)C(O)C(=O)O)c1.
What is the InChIKey of 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid?
The InChIKey is KCFJVVLIEFLRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO6/c11-6-2-4(1-5(3-6)9(14)15)7(12)8(13)10(16)17/h1-3,7-8,12-13H,(H,14,15)(H,16,17).
What are the key properties of 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid?
3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid has a molecular weight of 305.08 g/mol, XLogP of 0.63, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(2-carboxy-1,2-dihydroxyethyl)benzoic acid is sourced from PubChem (CID 170825091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).