C14H10Br2Cl2O2 — CID 139745260
1,2-bis(3-bromo-5-chlorophenyl)ethane-1,2-diol (PubChem CID 139745260) has the molecular formula C14H10Br2Cl2O2 and a molecular weight of 440.95 g/mol. Its IUPAC name is 1,2-bis(3-bromo-5-chlorophenyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(3-bromo-5-chlorophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 139745260 |
| Molecular Formula | C14H10Br2Cl2O2 |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 437.84 |
| IUPAC Name | 1,2-bis(3-bromo-5-chlorophenyl)ethane-1,2-diol |
| SMILES | OC(c1cc(Cl)cc(Br)c1)C(O)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C14H10Br2Cl2O2/c15-9-1-7(3-11(17)5-9)13(19)14(20)8-2-10(16)6-12(18)4-8/h1-6,13-14,19-20H |
| InChIKey | NUYUIGXPPRWAHC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |