C17H18BrClO — CID 107955397
(3-bromo-5-chlorophenyl)-(2,3,5,6-tetramethylphenyl)methanol (PubChem CID 107955397) has the molecular formula C17H18BrClO and a molecular weight of 353.69 g/mol. Its IUPAC name is (3-bromo-5-chlorophenyl)-(2,3,5,6-tetramethylphenyl)methanol.
| Compound Name | (3-bromo-5-chlorophenyl)-(2,3,5,6-tetramethylphenyl)methanol |
|---|---|
| PubChem CID | 107955397 |
| Molecular Formula | C17H18BrClO |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (3-bromo-5-chlorophenyl)-(2,3,5,6-tetramethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C)c(C(O)c2cc(Cl)cc(Br)c2)c1C |
| InChI | InChI=1S/C17H18BrClO/c1-9-5-10(2)12(4)16(11(9)3)17(20)13-6-14(18)8-15(19)7-13/h5-8,17,20H,1-4H3 |
| InChIKey | RKSACZHMRUAPHS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |