C17H17Br2Cl — CID 107980826
3-[chloro-(3,5-dibromophenyl)methyl]-1,2,4,5-tetramethylbenzene (PubChem CID 107980826) has the molecular formula C17H17Br2Cl and a molecular weight of 416.58 g/mol. Its IUPAC name is 3-[chloro-(3,5-dibromophenyl)methyl]-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-[chloro-(3,5-dibromophenyl)methyl]-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 107980826 |
| Molecular Formula | C17H17Br2Cl |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 3-[chloro-(3,5-dibromophenyl)methyl]-1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)c(C(Cl)c2cc(Br)cc(Br)c2)c1C |
| InChI | InChI=1S/C17H17Br2Cl/c1-9-5-10(2)12(4)16(11(9)3)17(20)13-6-14(18)8-15(19)7-13/h5-8,17H,1-4H3 |
| InChIKey | BVZKVSJLALRQJC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|