C14H9BrCl2F2 — CID 107959015
1-[(3-bromo-5-chlorophenyl)-chloromethyl]-2,5-difluoro-4-methylbenzene (PubChem CID 107959015) has the molecular formula C14H9BrCl2F2 and a molecular weight of 366.03 g/mol. Its IUPAC name is 1-[(3-bromo-5-chlorophenyl)-chloromethyl]-2,5-difluoro-4-methylbenzene.
| Compound Name | 1-[(3-bromo-5-chlorophenyl)-chloromethyl]-2,5-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 107959015 |
| Molecular Formula | C14H9BrCl2F2 |
| Molecular Weight | 366.03 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 1-[(3-bromo-5-chlorophenyl)-chloromethyl]-2,5-difluoro-4-methylbenzene |
| SMILES | Cc1cc(F)c(C(Cl)c2cc(Cl)cc(Br)c2)cc1F |
| InChI | InChI=1S/C14H9BrCl2F2/c1-7-2-13(19)11(6-12(7)18)14(17)8-3-9(15)5-10(16)4-8/h2-6,14H,1H3 |
| InChIKey | DIDXZSFMHXZBMJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.03 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|