C14H9BrClF2I — CID 114033442
1-[(5-bromo-2-iodophenyl)-chloromethyl]-2,5-difluoro-4-methylbenzene (PubChem CID 114033442) has the molecular formula C14H9BrClF2I and a molecular weight of 457.48 g/mol. Its IUPAC name is 1-[(5-bromo-2-iodophenyl)-chloromethyl]-2,5-difluoro-4-methylbenzene.
| Compound Name | 1-[(5-bromo-2-iodophenyl)-chloromethyl]-2,5-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 114033442 |
| Molecular Formula | C14H9BrClF2I |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 455.86 |
| IUPAC Name | 1-[(5-bromo-2-iodophenyl)-chloromethyl]-2,5-difluoro-4-methylbenzene |
| SMILES | Cc1cc(F)c(C(Cl)c2cc(Br)ccc2I)cc1F |
| InChI | InChI=1S/C14H9BrClF2I/c1-7-4-12(18)9(6-11(7)17)14(16)10-5-8(15)2-3-13(10)19/h2-6,14H,1H3 |
| InChIKey | SBOMNNCEQAXQDE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|