C15H12BrClF2 — CID 81476007
1-[(3-bromo-4-methylphenyl)-chloromethyl]-2,4-difluoro-5-methylbenzene (PubChem CID 81476007) has the molecular formula C15H12BrClF2 and a molecular weight of 345.61 g/mol. Its IUPAC name is 1-[(3-bromo-4-methylphenyl)-chloromethyl]-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-[(3-bromo-4-methylphenyl)-chloromethyl]-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 81476007 |
| Molecular Formula | C15H12BrClF2 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 1-[(3-bromo-4-methylphenyl)-chloromethyl]-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1cc(C(Cl)c2ccc(C)c(Br)c2)c(F)cc1F |
| InChI | InChI=1S/C15H12BrClF2/c1-8-3-4-10(6-12(8)16)15(17)11-5-9(2)13(18)7-14(11)19/h3-7,15H,1-2H3 |
| InChIKey | QWLGEJXFSYYUAJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|