C14H10ClF3 — CID 63434008
1-[chloro-(3-fluoro-4-methylphenyl)methyl]-2,4-difluorobenzene (PubChem CID 63434008) has the molecular formula C14H10ClF3 and a molecular weight of 270.68 g/mol. Its IUPAC name is 1-[chloro-(3-fluoro-4-methylphenyl)methyl]-2,4-difluorobenzene.
| Compound Name | 1-[chloro-(3-fluoro-4-methylphenyl)methyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 63434008 |
| Molecular Formula | C14H10ClF3 |
| Molecular Weight | 270.68 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1-[chloro-(3-fluoro-4-methylphenyl)methyl]-2,4-difluorobenzene |
| SMILES | Cc1ccc(C(Cl)c2ccc(F)cc2F)cc1F |
| InChI | InChI=1S/C14H10ClF3/c1-8-2-3-9(6-12(8)17)14(15)11-5-4-10(16)7-13(11)18/h2-7,14H,1H3 |
| InChIKey | XKNPABCMDIBLQG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|