C12H9ClF2S — CID 79807495
3-[chloro-(2,4-difluorophenyl)methyl]-4-methylthiophene (PubChem CID 79807495) has the molecular formula C12H9ClF2S and a molecular weight of 258.72 g/mol. Its IUPAC name is 3-[chloro-(2,4-difluorophenyl)methyl]-4-methylthiophene.
| Compound Name | 3-[chloro-(2,4-difluorophenyl)methyl]-4-methylthiophene |
|---|---|
| PubChem CID | 79807495 |
| Molecular Formula | C12H9ClF2S |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 3-[chloro-(2,4-difluorophenyl)methyl]-4-methylthiophene |
| SMILES | Cc1cscc1C(Cl)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H9ClF2S/c1-7-5-16-6-10(7)12(13)9-3-2-8(14)4-11(9)15/h2-6,12H,1H3 |
| InChIKey | OQWDHGSMNCUEGJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|