C13H11ClF2O — CID 61084571
3-[chloro-(2,4-difluorophenyl)methyl]-2,5-dimethylfuran (PubChem CID 61084571) has the molecular formula C13H11ClF2O and a molecular weight of 256.68 g/mol. Its IUPAC name is 3-[chloro-(2,4-difluorophenyl)methyl]-2,5-dimethylfuran.
| Compound Name | 3-[chloro-(2,4-difluorophenyl)methyl]-2,5-dimethylfuran |
|---|---|
| PubChem CID | 61084571 |
| Molecular Formula | C13H11ClF2O |
| Molecular Weight | 256.68 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-[chloro-(2,4-difluorophenyl)methyl]-2,5-dimethylfuran |
| SMILES | Cc1cc(C(Cl)c2ccc(F)cc2F)c(C)o1 |
| InChI | InChI=1S/C13H11ClF2O/c1-7-5-11(8(2)17-7)13(14)10-4-3-9(15)6-12(10)16/h3-6,13H,1-2H3 |
| InChIKey | WQRQYUXUFBUXRB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.68 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|