C14H15F2NO — CID 43121314
N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2,4-difluoroaniline (PubChem CID 43121314) has the molecular formula C14H15F2NO and a molecular weight of 251.28 g/mol. Its IUPAC name is N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2,4-difluoroaniline.
| Compound Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 43121314 |
| Molecular Formula | C14H15F2NO |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-2,4-difluoroaniline |
| SMILES | Cc1cc(C(C)Nc2ccc(F)cc2F)c(C)o1 |
| InChI | InChI=1S/C14H15F2NO/c1-8-6-12(10(3)18-8)9(2)17-14-5-4-11(15)7-13(14)16/h4-7,9,17H,1-3H3 |
| InChIKey | HILWPOMFSPGMEO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |