C14H12BrF2N — CID 43195353
N-[1-(2-bromophenyl)ethyl]-2,4-difluoroaniline (PubChem CID 43195353) has the molecular formula C14H12BrF2N and a molecular weight of 312.16 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)ethyl]-2,4-difluoroaniline.
| Compound Name | N-[1-(2-bromophenyl)ethyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 43195353 |
| Molecular Formula | C14H12BrF2N |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | N-[1-(2-bromophenyl)ethyl]-2,4-difluoroaniline |
| SMILES | CC(Nc1ccc(F)cc1F)c1ccccc1Br |
| InChI | InChI=1S/C14H12BrF2N/c1-9(11-4-2-3-5-12(11)15)18-14-7-6-10(16)8-13(14)17/h2-9,18H,1H3 |
| InChIKey | BGRMGCFATPBRTF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |