C15H18INO — CID 114256989
N-[1-(2,5-dimethylfuran-3-yl)ethyl]-5-iodo-2-methylaniline (PubChem CID 114256989) has the molecular formula C15H18INO and a molecular weight of 355.22 g/mol. Its IUPAC name is N-[1-(2,5-dimethylfuran-3-yl)ethyl]-5-iodo-2-methylaniline.
| Compound Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-5-iodo-2-methylaniline |
|---|---|
| PubChem CID | 114256989 |
| Molecular Formula | C15H18INO |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-5-iodo-2-methylaniline |
| SMILES | Cc1cc(C(C)Nc2cc(I)ccc2C)c(C)o1 |
| InChI | InChI=1S/C15H18INO/c1-9-5-6-13(16)8-15(9)17-11(3)14-7-10(2)18-12(14)4/h5-8,11,17H,1-4H3 |
| InChIKey | OXAFNHRBRKOGDN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|