C14H16FNO — CID 43121304
N-[1-(2,5-dimethylfuran-3-yl)ethyl]-4-fluoroaniline (PubChem CID 43121304) has the molecular formula C14H16FNO and a molecular weight of 233.29 g/mol. Its IUPAC name is N-[1-(2,5-dimethylfuran-3-yl)ethyl]-4-fluoroaniline.
| Compound Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 43121304 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-[1-(2,5-dimethylfuran-3-yl)ethyl]-4-fluoroaniline |
| SMILES | Cc1cc(C(C)Nc2ccc(F)cc2)c(C)o1 |
| InChI | InChI=1S/C14H16FNO/c1-9-8-14(11(3)17-9)10(2)16-13-6-4-12(15)5-7-13/h4-8,10,16H,1-3H3 |
| InChIKey | KHVDCWDMIRZVIG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |