C15H16ClF2NO2 — CID 43121348
3-chloro-4-(difluoromethoxy)-N-[1-(2,5-dimethylfuran-3-yl)ethyl]aniline (PubChem CID 43121348) has the molecular formula C15H16ClF2NO2 and a molecular weight of 315.75 g/mol. Its IUPAC name is 3-chloro-4-(difluoromethoxy)-N-[1-(2,5-dimethylfuran-3-yl)ethyl]aniline.
| Compound Name | 3-chloro-4-(difluoromethoxy)-N-[1-(2,5-dimethylfuran-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 43121348 |
| Molecular Formula | C15H16ClF2NO2 |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-chloro-4-(difluoromethoxy)-N-[1-(2,5-dimethylfuran-3-yl)ethyl]aniline |
| SMILES | Cc1cc(C(C)Nc2ccc(OC(F)F)c(Cl)c2)c(C)o1 |
| InChI | InChI=1S/C15H16ClF2NO2/c1-8-6-12(10(3)20-8)9(2)19-11-4-5-14(13(16)7-11)21-15(17)18/h4-7,9,15,19H,1-3H3 |
| InChIKey | IZSRKQMCQIDLPV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|