C15H15BrN2O — CID 107276207
2-bromo-4-[1-(2,5-dimethylfuran-3-yl)ethylamino]benzonitrile (PubChem CID 107276207) has the molecular formula C15H15BrN2O and a molecular weight of 319.20 g/mol. Its IUPAC name is 2-bromo-4-[1-(2,5-dimethylfuran-3-yl)ethylamino]benzonitrile.
| Compound Name | 2-bromo-4-[1-(2,5-dimethylfuran-3-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 107276207 |
| Molecular Formula | C15H15BrN2O |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-bromo-4-[1-(2,5-dimethylfuran-3-yl)ethylamino]benzonitrile |
| SMILES | Cc1cc(C(C)Nc2ccc(C#N)c(Br)c2)c(C)o1 |
| InChI | InChI=1S/C15H15BrN2O/c1-9-6-14(11(3)19-9)10(2)18-13-5-4-12(8-17)15(16)7-13/h4-7,10,18H,1-3H3 |
| InChIKey | RMEBOQRRQSSXAS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 48.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |