C12H16BrN3 — CID 107280757
4-[(1-amino-3-methylbutan-2-yl)amino]-2-bromobenzonitrile (PubChem CID 107280757) has the molecular formula C12H16BrN3 and a molecular weight of 282.19 g/mol. Its IUPAC name is 4-[(1-amino-3-methylbutan-2-yl)amino]-2-bromobenzonitrile.
| Compound Name | 4-[(1-amino-3-methylbutan-2-yl)amino]-2-bromobenzonitrile |
|---|---|
| PubChem CID | 107280757 |
| Molecular Formula | C12H16BrN3 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-[(1-amino-3-methylbutan-2-yl)amino]-2-bromobenzonitrile |
| SMILES | CC(C)C(CN)Nc1ccc(C#N)c(Br)c1 |
| InChI | InChI=1S/C12H16BrN3/c1-8(2)12(7-15)16-10-4-3-9(6-14)11(13)5-10/h3-5,8,12,16H,7,15H2,1-2H3 |
| InChIKey | VVJKGDKJNMVVAZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |