C11H16BrFN2 — CID 104776446
2-N-(3-bromo-4-fluorophenyl)-3-methylbutane-1,2-diamine (PubChem CID 104776446) has the molecular formula C11H16BrFN2 and a molecular weight of 275.17 g/mol. Its IUPAC name is 2-N-(3-bromo-4-fluorophenyl)-3-methylbutane-1,2-diamine.
| Compound Name | 2-N-(3-bromo-4-fluorophenyl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 104776446 |
| Molecular Formula | C11H16BrFN2 |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-N-(3-bromo-4-fluorophenyl)-3-methylbutane-1,2-diamine |
| SMILES | CC(C)C(CN)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H16BrFN2/c1-7(2)11(6-14)15-8-3-4-10(13)9(12)5-8/h3-5,7,11,15H,6,14H2,1-2H3 |
| InChIKey | DUBWVYMFLDHNGF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |