C11H16ClFN2 — CID 115137933
2-N-(5-chloro-2-fluorophenyl)-3-methylbutane-1,2-diamine (PubChem CID 115137933) has the molecular formula C11H16ClFN2 and a molecular weight of 230.71 g/mol. Its IUPAC name is 2-N-(5-chloro-2-fluorophenyl)-3-methylbutane-1,2-diamine.
| Compound Name | 2-N-(5-chloro-2-fluorophenyl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 115137933 |
| Molecular Formula | C11H16ClFN2 |
| Molecular Weight | 230.71 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-N-(5-chloro-2-fluorophenyl)-3-methylbutane-1,2-diamine |
| SMILES | CC(C)C(CN)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H16ClFN2/c1-7(2)11(6-14)15-10-5-8(12)3-4-9(10)13/h3-5,7,11,15H,6,14H2,1-2H3 |
| InChIKey | WKAFHNOBIHOLDP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.71 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |