C9H12Cl2N2 — CID 103387065
2-N-(2,4-dichlorophenyl)propane-1,2-diamine (PubChem CID 103387065) has the molecular formula C9H12Cl2N2 and a molecular weight of 219.12 g/mol. Its IUPAC name is 2-N-(2,4-dichlorophenyl)propane-1,2-diamine.
| Compound Name | 2-N-(2,4-dichlorophenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 103387065 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 2-N-(2,4-dichlorophenyl)propane-1,2-diamine |
| SMILES | CC(CN)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H12Cl2N2/c1-6(5-12)13-9-3-2-7(10)4-8(9)11/h2-4,6,13H,5,12H2,1H3 |
| InChIKey | CLJGAMMUKJREJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |