C13H12Cl2N2 — CID 43192035
2,4-dichloro-N-(1-pyridin-4-ylethyl)aniline (PubChem CID 43192035) has the molecular formula C13H12Cl2N2 and a molecular weight of 267.16 g/mol. Its IUPAC name is 2,4-dichloro-N-(1-pyridin-4-ylethyl)aniline.
| Compound Name | 2,4-dichloro-N-(1-pyridin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 43192035 |
| Molecular Formula | C13H12Cl2N2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2,4-dichloro-N-(1-pyridin-4-ylethyl)aniline |
| SMILES | CC(Nc1ccc(Cl)cc1Cl)c1ccncc1 |
| InChI | InChI=1S/C13H12Cl2N2/c1-9(10-4-6-16-7-5-10)17-13-3-2-11(14)8-12(13)15/h2-9,17H,1H3 |
| InChIKey | YBTXPQLNXNOUSL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |