C14H14Cl2N2 — CID 104726127
2,5-dichloro-4-methyl-N-(1-pyridin-4-ylethyl)aniline (PubChem CID 104726127) has the molecular formula C14H14Cl2N2 and a molecular weight of 281.19 g/mol. Its IUPAC name is 2,5-dichloro-4-methyl-N-(1-pyridin-4-ylethyl)aniline.
| Compound Name | 2,5-dichloro-4-methyl-N-(1-pyridin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 104726127 |
| Molecular Formula | C14H14Cl2N2 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2,5-dichloro-4-methyl-N-(1-pyridin-4-ylethyl)aniline |
| SMILES | Cc1cc(Cl)c(NC(C)c2ccncc2)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2/c1-9-7-13(16)14(8-12(9)15)18-10(2)11-3-5-17-6-4-11/h3-8,10,18H,1-2H3 |
| InChIKey | YZJVAPRSDXAVMF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |