C16H18Cl2N2 — CID 43758692
2,4-dichloro-N-[1-[4-(dimethylamino)phenyl]ethyl]aniline (PubChem CID 43758692) has the molecular formula C16H18Cl2N2 and a molecular weight of 309.24 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[4-(dimethylamino)phenyl]ethyl]aniline.
| Compound Name | 2,4-dichloro-N-[1-[4-(dimethylamino)phenyl]ethyl]aniline |
|---|---|
| PubChem CID | 43758692 |
| Molecular Formula | C16H18Cl2N2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2,4-dichloro-N-[1-[4-(dimethylamino)phenyl]ethyl]aniline |
| SMILES | CC(Nc1ccc(Cl)cc1Cl)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H18Cl2N2/c1-11(12-4-7-14(8-5-12)20(2)3)19-16-9-6-13(17)10-15(16)18/h4-11,19H,1-3H3 |
| InChIKey | XTXYHWJACZNECC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|