C11H16Cl2N2 — CID 54806248
N-(2,4-dichlorophenyl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 54806248) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(2,4-dichlorophenyl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 54806248 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(2,4-dichlorophenyl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl2N2/c1-8(2)14-5-6-15-11-4-3-9(12)7-10(11)13/h3-4,7-8,14-15H,5-6H2,1-2H3 |
| InChIKey | HKPHQNXGMNTTEH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|