C11H14BrCl2N — CID 10804944
N-(5-bromopentyl)-2,4-dichloroaniline (PubChem CID 10804944) has the molecular formula C11H14BrCl2N and a molecular weight of 311.05 g/mol. Its IUPAC name is N-(5-bromopentyl)-2,4-dichloroaniline.
| Compound Name | N-(5-bromopentyl)-2,4-dichloroaniline |
|---|---|
| PubChem CID | 10804944 |
| Molecular Formula | C11H14BrCl2N |
| Molecular Weight | 311.05 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | N-(5-bromopentyl)-2,4-dichloroaniline |
| SMILES | Clc1ccc(NCCCCCBr)c(Cl)c1 |
| InChI | InChI=1S/C11H14BrCl2N/c12-6-2-1-3-7-15-11-5-4-9(13)8-10(11)14/h4-5,8,15H,1-3,6-7H2 |
| InChIKey | NCOWEMPTMPEGCH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|