C9H14Cl2N2 — CID 143596741
1-(2,4-dichlorophenyl)-2-methylhydrazine;ethane (PubChem CID 143596741) has the molecular formula C9H14Cl2N2 and a molecular weight of 221.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-methylhydrazine;ethane.
| Compound Name | 1-(2,4-dichlorophenyl)-2-methylhydrazine;ethane |
|---|---|
| PubChem CID | 143596741 |
| Molecular Formula | C9H14Cl2N2 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-methylhydrazine;ethane |
| SMILES | CC.CNNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H8Cl2N2.C2H6/c1-10-11-7-3-2-5(8)4-6(7)9;1-2/h2-4,10-11H,1H3;1-2H3 |
| InChIKey | UAZQHJQAWFSGII-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|