C10H10Cl2N2O2 — CID 117063535
(E)-2-[2-(2,4-dichlorophenyl)hydrazinyl]but-2-enoic acid (PubChem CID 117063535) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is (E)-2-[2-(2,4-dichlorophenyl)hydrazinyl]but-2-enoic acid.
| Compound Name | (E)-2-[2-(2,4-dichlorophenyl)hydrazinyl]but-2-enoic acid |
|---|---|
| PubChem CID | 117063535 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | (E)-2-[2-(2,4-dichlorophenyl)hydrazinyl]but-2-enoic acid |
| SMILES | C/C=C(/NNc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-2-8(10(15)16)13-14-9-4-3-6(11)5-7(9)12/h2-5,13-14H,1H3,(H,15,16)/b8-2+ |
| InChIKey | FSQPQASBYIYHRA-KRXBUXKQSA-N |
| XLogP | 2.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|