C15H19Cl4N3O2 — CID 142632465
2,2-dichloro-N-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]propanamide (PubChem CID 142632465) has the molecular formula C15H19Cl4N3O2 and a molecular weight of 415.15 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]propanamide.
| Compound Name | 2,2-dichloro-N-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]propanamide |
|---|---|
| PubChem CID | 142632465 |
| Molecular Formula | C15H19Cl4N3O2 |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 2,2-dichloro-N-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]propanamide |
| SMILES | CC(C)CC(NC(=O)C(C)(Cl)Cl)C(=O)NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl4N3O2/c1-8(2)6-12(20-14(24)15(3,18)19)13(23)22-21-11-5-4-9(16)7-10(11)17/h4-5,7-8,12,21H,6H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | WORXODIGJMPRAT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|