C19H20Cl2F2N4O2 — CID 142632468
1-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-3-(2,6-difluorophenyl)urea (PubChem CID 142632468) has the molecular formula C19H20Cl2F2N4O2 and a molecular weight of 445.30 g/mol. Its IUPAC name is 1-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 142632468 |
| Molecular Formula | C19H20Cl2F2N4O2 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 1-[1-[2-(2,4-dichlorophenyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-3-(2,6-difluorophenyl)urea |
| SMILES | CC(C)CC(NC(=O)Nc1c(F)cccc1F)C(=O)NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2F2N4O2/c1-10(2)8-16(18(28)27-26-15-7-6-11(20)9-12(15)21)24-19(29)25-17-13(22)4-3-5-14(17)23/h3-7,9-10,16,26H,8H2,1-2H3,(H,27,28)(H2,24,25,29) |
| InChIKey | ZGFZYCCDGLIWDU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|