C13H8Cl3FN2O — CID 108896387
1-(2-chloro-6-fluorophenyl)-3-(2,4-dichlorophenyl)urea (PubChem CID 108896387) has the molecular formula C13H8Cl3FN2O and a molecular weight of 333.58 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 108896387 |
| Molecular Formula | C13H8Cl3FN2O |
| Molecular Weight | 333.58 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)Nc1c(F)cccc1Cl |
| InChI | InChI=1S/C13H8Cl3FN2O/c14-7-4-5-11(9(16)6-7)18-13(20)19-12-8(15)2-1-3-10(12)17/h1-6H,(H2,18,19,20) |
| InChIKey | GRJOKGPZNRSMPP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |