C8H8ClFN2O — CID 21161279
1-(2-chloro-6-fluorophenyl)-3-methylurea (PubChem CID 21161279) has the molecular formula C8H8ClFN2O and a molecular weight of 202.62 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-3-methylurea.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-3-methylurea |
|---|---|
| PubChem CID | 21161279 |
| Molecular Formula | C8H8ClFN2O |
| Molecular Weight | 202.62 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1c(F)cccc1Cl |
| InChI | InChI=1S/C8H8ClFN2O/c1-11-8(13)12-7-5(9)3-2-4-6(7)10/h2-4H,1H3,(H2,11,12,13) |
| InChIKey | LZSUNGJYYCCRDT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.62 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |