C13H16ClFN4O — CID 70524031
1-[N-(2-chloro-6-fluorophenyl)-N'-(cyclopropylmethyl)carbamimidoyl]-3-methylurea (PubChem CID 70524031) has the molecular formula C13H16ClFN4O and a molecular weight of 298.75 g/mol. Its IUPAC name is 1-[N-(2-chloro-6-fluorophenyl)-N'-(cyclopropylmethyl)carbamimidoyl]-3-methylurea.
| Compound Name | 1-[N-(2-chloro-6-fluorophenyl)-N'-(cyclopropylmethyl)carbamimidoyl]-3-methylurea |
|---|---|
| PubChem CID | 70524031 |
| Molecular Formula | C13H16ClFN4O |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[N-(2-chloro-6-fluorophenyl)-N'-(cyclopropylmethyl)carbamimidoyl]-3-methylurea |
| SMILES | CNC(=O)N/C(=N\CC1CC1)Nc1c(F)cccc1Cl |
| InChI | InChI=1S/C13H16ClFN4O/c1-16-13(20)19-12(17-7-8-5-6-8)18-11-9(14)3-2-4-10(11)15/h2-4,8H,5-7H2,1H3,(H3,16,17,18,19,20) |
| InChIKey | OWXUOXZGJSVMEK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|