C20H20ClF2N3O2 — CID 50817585
N-[N-(3-chloro-2-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 50817585) has the molecular formula C20H20ClF2N3O2 and a molecular weight of 407.85 g/mol. Its IUPAC name is N-[N-(3-chloro-2-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-(3-chloro-2-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 50817585 |
| Molecular Formula | C20H20ClF2N3O2 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[N-(3-chloro-2-methylphenyl)-N'-(oxolan-2-ylmethyl)carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | Cc1c(Cl)cccc1N/C(=N/CC1CCCO1)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H20ClF2N3O2/c1-12-15(21)5-2-6-18(12)25-20(24-11-14-4-3-9-28-14)26-19(27)13-7-8-16(22)17(23)10-13/h2,5-8,10,14H,3-4,9,11H2,1H3,(H2,24,25,26,27) |
| InChIKey | QZSCZTXUOCFFOA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|