C20H21ClFN3O3 — CID 94089634
N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide (PubChem CID 94089634) has the molecular formula C20H21ClFN3O3 and a molecular weight of 405.86 g/mol. Its IUPAC name is N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide.
| Compound Name | N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 94089634 |
| Molecular Formula | C20H21ClFN3O3 |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[N-(5-chloro-2-methoxyphenyl)-N'-[[(2R)-oxolan-2-yl]methyl]carbamimidoyl]-4-fluorobenzamide |
| SMILES | COc1ccc(Cl)cc1N/C(=N/C[C@H]1CCCO1)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21ClFN3O3/c1-27-18-9-6-14(21)11-17(18)24-20(23-12-16-3-2-10-28-16)25-19(26)13-4-7-15(22)8-5-13/h4-9,11,16H,2-3,10,12H2,1H3,(H2,23,24,25,26)/t16-/m1/s1 |
| InChIKey | SYOXWEHJBSQPNT-MRXNPFEDSA-N |
| XLogP | 3.86 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|